C18H22N2O5 — CID 162504409
3-[(5S)-5-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-oxo-1,3-oxazolidin-3-yl]piperidine-2,6-dione (PubChem CID 162504409) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 3-[(5S)-5-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-oxo-1,3-oxazolidin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[(5S)-5-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-oxo-1,3-oxazolidin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162504409 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3-[(5S)-5-[4-[(2-methylpropan-2-yl)oxy]phenyl]-2-oxo-1,3-oxazolidin-3-yl]piperidine-2,6-dione |
| SMILES | CC(C)(C)Oc1ccc([C@H]2CN(C3CCC(=O)NC3=O)C(=O)O2)cc1 |
| InChI | InChI=1S/C18H22N2O5/c1-18(2,3)25-12-6-4-11(5-7-12)14-10-20(17(23)24-14)13-8-9-15(21)19-16(13)22/h4-7,13-14H,8-10H2,1-3H3,(H,19,21,22)/t13?,14-/m1/s1 |
| InChIKey | XDFWIIGTYKFMAB-ARLHGKGLSA-N |
| XLogP | 2.16 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|