C24H22N2O7S — CID 166784354
4-[4-[3-[(5S)-3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-oxazolidin-5-yl]phenyl]but-3-ynyl]benzenesulfonic acid (PubChem CID 166784354) has the molecular formula C24H22N2O7S and a molecular weight of 482.51 g/mol. Its IUPAC name is 4-[4-[3-[(5S)-3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-oxazolidin-5-yl]phenyl]but-3-ynyl]benzenesulfonic acid.
| Compound Name | 4-[4-[3-[(5S)-3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-oxazolidin-5-yl]phenyl]but-3-ynyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 166784354 |
| Molecular Formula | C24H22N2O7S |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 4-[4-[3-[(5S)-3-(2,6-dioxopiperidin-3-yl)-2-oxo-1,3-oxazolidin-5-yl]phenyl]but-3-ynyl]benzenesulfonic acid |
| SMILES | O=C1CCC(N2C[C@H](c3cccc(C#CCCc4ccc(S(=O)(=O)O)cc4)c3)OC2=O)C(=O)N1 |
| InChI | InChI=1S/C24H22N2O7S/c27-22-13-12-20(23(28)25-22)26-15-21(33-24(26)29)18-7-3-6-17(14-18)5-2-1-4-16-8-10-19(11-9-16)34(30,31)32/h3,6-11,14,20-21H,1,4,12-13,15H2,(H,25,27,28)(H,30,31,32)/t20?,21-/m1/s1 |
| InChIKey | NDMSRKXOVKQZOU-BPGUCPLFSA-N |
| XLogP | 2.22 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|