C23H21ClN4O3S — CID 162505032
2-chloro-4-[2-methoxy-3-[2-(oxan-4-yl)-1,3-thiazol-5-yl]anilino]-6H-1,6-naphthyridin-5-one (PubChem CID 162505032) has the molecular formula C23H21ClN4O3S and a molecular weight of 468.97 g/mol. Its IUPAC name is 2-chloro-4-[2-methoxy-3-[2-(oxan-4-yl)-1,3-thiazol-5-yl]anilino]-6H-1,6-naphthyridin-5-one.
| Compound Name | 2-chloro-4-[2-methoxy-3-[2-(oxan-4-yl)-1,3-thiazol-5-yl]anilino]-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 162505032 |
| Molecular Formula | C23H21ClN4O3S |
| Molecular Weight | 468.97 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 2-chloro-4-[2-methoxy-3-[2-(oxan-4-yl)-1,3-thiazol-5-yl]anilino]-6H-1,6-naphthyridin-5-one |
| SMILES | COc1c(Nc2cc(Cl)nc3cc[nH]c(=O)c23)cccc1-c1cnc(C2CCOCC2)s1 |
| InChI | InChI=1S/C23H21ClN4O3S/c1-30-21-14(18-12-26-23(32-18)13-6-9-31-10-7-13)3-2-4-16(21)27-17-11-19(24)28-15-5-8-25-22(29)20(15)17/h2-5,8,11-13H,6-7,9-10H2,1H3,(H,25,29)(H,27,28) |
| InChIKey | WVPXFQBCGLHQND-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.97 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|