C15H13Br2NO4 — CID 162509067
2-(2,2-dibromoacetyl)oxyethyl 4-aminonaphthalene-1-carboxylate (PubChem CID 162509067) has the molecular formula C15H13Br2NO4 and a molecular weight of 431.08 g/mol. Its IUPAC name is 2-(2,2-dibromoacetyl)oxyethyl 4-aminonaphthalene-1-carboxylate.
| Compound Name | 2-(2,2-dibromoacetyl)oxyethyl 4-aminonaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 162509067 |
| Molecular Formula | C15H13Br2NO4 |
| Molecular Weight | 431.08 g/mol |
| Exact Mass | 428.92 |
| IUPAC Name | 2-(2,2-dibromoacetyl)oxyethyl 4-aminonaphthalene-1-carboxylate |
| SMILES | Nc1ccc(C(=O)OCCOC(=O)C(Br)Br)c2ccccc12 |
| InChI | InChI=1S/C15H13Br2NO4/c16-13(17)15(20)22-8-7-21-14(19)11-5-6-12(18)10-4-2-1-3-9(10)11/h1-6,13H,7-8,18H2 |
| InChIKey | GJQYINSOLQEPBQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.08 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|