C16H17F3N2O4 — CID 162514878
tert-butyl 3-[4-(trifluoromethyl)benzoyl]oxyiminoazetidine-1-carboxylate (PubChem CID 162514878) has the molecular formula C16H17F3N2O4 and a molecular weight of 358.32 g/mol. Its IUPAC name is tert-butyl 3-[4-(trifluoromethyl)benzoyl]oxyiminoazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(trifluoromethyl)benzoyl]oxyiminoazetidine-1-carboxylate |
|---|---|
| PubChem CID | 162514878 |
| Molecular Formula | C16H17F3N2O4 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | tert-butyl 3-[4-(trifluoromethyl)benzoyl]oxyiminoazetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=NOC(=O)c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C16H17F3N2O4/c1-15(2,3)24-14(23)21-8-12(9-21)20-25-13(22)10-4-6-11(7-5-10)16(17,18)19/h4-7H,8-9H2,1-3H3 |
| InChIKey | BKXFOGSNYZSACX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|