C17H10F6N6O — CID 162515381
N-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyrimidin-5-ylprop-2-enamide (PubChem CID 162515381) has the molecular formula C17H10F6N6O and a molecular weight of 428.30 g/mol. Its IUPAC name is N-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyrimidin-5-ylprop-2-enamide.
| Compound Name | N-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyrimidin-5-ylprop-2-enamide |
|---|---|
| PubChem CID | 162515381 |
| Molecular Formula | C17H10F6N6O |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | N-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-pyrimidin-5-ylprop-2-enamide |
| SMILES | C=C(C(=O)Nn1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cncnc1 |
| InChI | InChI=1S/C17H10F6N6O/c1-9(11-5-24-7-25-6-11)15(30)28-29-8-26-14(27-29)10-2-12(16(18,19)20)4-13(3-10)17(21,22)23/h2-8H,1H2,(H,28,30) |
| InChIKey | BJRLAOFFWZSJRR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|