C19H11F6N5O — CID 130197670
(Z)-3-[4-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-2-yl]-2-pyrimidin-5-ylprop-2-enamide (PubChem CID 130197670) has the molecular formula C19H11F6N5O and a molecular weight of 439.32 g/mol. Its IUPAC name is (Z)-3-[4-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-2-yl]-2-pyrimidin-5-ylprop-2-enamide.
| Compound Name | (Z)-3-[4-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-2-yl]-2-pyrimidin-5-ylprop-2-enamide |
|---|---|
| PubChem CID | 130197670 |
| Molecular Formula | C19H11F6N5O |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | (Z)-3-[4-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-2-yl]-2-pyrimidin-5-ylprop-2-enamide |
| SMILES | NC(=O)/C(=C\c1nccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cncnc1 |
| InChI | InChI=1S/C19H11F6N5O/c20-18(21,22)12-3-10(4-13(5-12)19(23,24)25)15-1-2-29-16(30-15)6-14(17(26)31)11-7-27-9-28-8-11/h1-9H,(H2,26,31)/b14-6- |
| InChIKey | SNEGSAZBONJEKE-NSIKDUERSA-N |
| XLogP | 4.00 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|