C21H13F6N3O — CID 130176995
(E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-phenylprop-2-enamide (PubChem CID 130176995) has the molecular formula C21H13F6N3O and a molecular weight of 437.34 g/mol. Its IUPAC name is (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-phenylprop-2-enamide.
| Compound Name | (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 130176995 |
| Molecular Formula | C21H13F6N3O |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-phenylprop-2-enamide |
| SMILES | NC(=O)/C(=C/c1ccnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1ccccc1 |
| InChI | InChI=1S/C21H13F6N3O/c22-20(23,24)14-8-13(9-15(10-14)21(25,26)27)19-29-7-6-16(30-19)11-17(18(28)31)12-4-2-1-3-5-12/h1-11H,(H2,28,31)/b17-11+ |
| InChIKey | QJISQTIJUZUJIG-GZTJUZNOSA-N |
| XLogP | 5.21 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|