C25H20F6N4O3S — CID 130197691
(E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-(3-methylazetidin-1-yl)sulfonylphenyl]prop-2-enamide (PubChem CID 130197691) has the molecular formula C25H20F6N4O3S and a molecular weight of 570.52 g/mol. Its IUPAC name is (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-(3-methylazetidin-1-yl)sulfonylphenyl]prop-2-enamide.
| Compound Name | (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-(3-methylazetidin-1-yl)sulfonylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 130197691 |
| Molecular Formula | C25H20F6N4O3S |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-(3-methylazetidin-1-yl)sulfonylphenyl]prop-2-enamide |
| SMILES | CC1CN(S(=O)(=O)c2cccc(/C(=C\c3ccnc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)n3)C(N)=O)c2)C1 |
| InChI | InChI=1S/C25H20F6N4O3S/c1-14-12-35(13-14)39(37,38)20-4-2-3-15(9-20)21(22(32)36)11-19-5-6-33-23(34-19)16-7-17(24(26,27)28)10-18(8-16)25(29,30)31/h2-11,14H,12-13H2,1H3,(H2,32,36)/b21-11+ |
| InChIKey | SAZKMAZLRVKZPW-SRZZPIQSSA-N |
| XLogP | 4.85 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|