C24H16F8N4OS — CID 145347121
(E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-(3,3-difluoroazetidin-1-yl)sulfanylphenyl]prop-2-enamide (PubChem CID 145347121) has the molecular formula C24H16F8N4OS and a molecular weight of 560.47 g/mol. Its IUPAC name is (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-(3,3-difluoroazetidin-1-yl)sulfanylphenyl]prop-2-enamide.
| Compound Name | (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-(3,3-difluoroazetidin-1-yl)sulfanylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 145347121 |
| Molecular Formula | C24H16F8N4OS |
| Molecular Weight | 560.47 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-[3-(3,3-difluoroazetidin-1-yl)sulfanylphenyl]prop-2-enamide |
| SMILES | NC(=O)/C(=C/c1ccnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cccc(SN2CC(F)(F)C2)c1 |
| InChI | InChI=1S/C24H16F8N4OS/c25-22(26)11-36(12-22)38-18-3-1-2-13(8-18)19(20(33)37)10-17-4-5-34-21(35-17)14-6-15(23(27,28)29)9-16(7-14)24(30,31)32/h1-10H,11-12H2,(H2,33,37)/b19-10+ |
| InChIKey | NHLPAUHEWIQERK-VXLYETTFSA-N |
| XLogP | 6.17 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.47 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|