C15H10F3NO2S — CID 162522080
N-[2-formyl-5-[3-(trifluoromethyl)phenyl]thiophen-3-yl]prop-2-enamide (PubChem CID 162522080) has the molecular formula C15H10F3NO2S and a molecular weight of 325.31 g/mol. Its IUPAC name is N-[2-formyl-5-[3-(trifluoromethyl)phenyl]thiophen-3-yl]prop-2-enamide.
| Compound Name | N-[2-formyl-5-[3-(trifluoromethyl)phenyl]thiophen-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 162522080 |
| Molecular Formula | C15H10F3NO2S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N-[2-formyl-5-[3-(trifluoromethyl)phenyl]thiophen-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2cccc(C(F)(F)F)c2)sc1C=O |
| InChI | InChI=1S/C15H10F3NO2S/c1-2-14(21)19-11-7-12(22-13(11)8-20)9-4-3-5-10(6-9)15(16,17)18/h2-8H,1H2,(H,19,21) |
| InChIKey | GTYSYRDJALHLEK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|