C21H23BrCl2O2 — CID 162522351
2-[4-[(4-bromo-2,6-dichlorophenyl)methyl]-2-propan-2-ylphenoxy]oxane (PubChem CID 162522351) has the molecular formula C21H23BrCl2O2 and a molecular weight of 458.22 g/mol. Its IUPAC name is 2-[4-[(4-bromo-2,6-dichlorophenyl)methyl]-2-propan-2-ylphenoxy]oxane.
| Compound Name | 2-[4-[(4-bromo-2,6-dichlorophenyl)methyl]-2-propan-2-ylphenoxy]oxane |
|---|---|
| PubChem CID | 162522351 |
| Molecular Formula | C21H23BrCl2O2 |
| Molecular Weight | 458.22 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | 2-[4-[(4-bromo-2,6-dichlorophenyl)methyl]-2-propan-2-ylphenoxy]oxane |
| SMILES | CC(C)c1cc(Cc2c(Cl)cc(Br)cc2Cl)ccc1OC1CCCCO1 |
| InChI | InChI=1S/C21H23BrCl2O2/c1-13(2)16-9-14(10-17-18(23)11-15(22)12-19(17)24)6-7-20(16)26-21-5-3-4-8-25-21/h6-7,9,11-13,21H,3-5,8,10H2,1-2H3 |
| InChIKey | JVAUQEVLABRHLP-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.22 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |