C9H16N4O — CID 162527766
2-imino-2-(methylideneamino)-N-(1-methylpiperidin-4-yl)acetamide (PubChem CID 162527766) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-imino-2-(methylideneamino)-N-(1-methylpiperidin-4-yl)acetamide.
| Compound Name | 2-imino-2-(methylideneamino)-N-(1-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 162527766 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2-imino-2-(methylideneamino)-N-(1-methylpiperidin-4-yl)acetamide |
| SMILES | [H]/N=C(\N=C)C(=O)NC1CCN(C)CC1 |
| InChI | InChI=1S/C9H16N4O/c1-11-8(10)9(14)12-7-3-5-13(2)6-4-7/h7,10H,1,3-6H2,2H3,(H,12,14)/b10-8- |
| InChIKey | APOTUXWYEBGMST-NTMALXAHSA-N |
| XLogP | -0.13 |
| TPSA | 68.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|