C14H30N6O — CID 138741981
(2S)-2-amino-5-(diaminomethylideneamino)-N-(1-propan-2-ylpiperidin-4-yl)pentanamide (PubChem CID 138741981) has the molecular formula C14H30N6O and a molecular weight of 298.44 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)-N-(1-propan-2-ylpiperidin-4-yl)pentanamide.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-(1-propan-2-ylpiperidin-4-yl)pentanamide |
|---|---|
| PubChem CID | 138741981 |
| Molecular Formula | C14H30N6O |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-(1-propan-2-ylpiperidin-4-yl)pentanamide |
| SMILES | CC(C)N1CCC(NC(=O)[C@@H](N)CCCN=C(N)N)CC1 |
| InChI | InChI=1S/C14H30N6O/c1-10(2)20-8-5-11(6-9-20)19-13(21)12(15)4-3-7-18-14(16)17/h10-12H,3-9,15H2,1-2H3,(H,19,21)(H4,16,17,18)/t12-/m0/s1 |
| InChIKey | WCYYBOXUDDWEBF-LBPRGKRZSA-N |
| XLogP | -0.64 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.44 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|