C22H21F3N8O2 — CID 162530152
[N'-[5-[2-(7-amino-2,3-dimethylpyrido[3,4-b]pyrazin-8-yl)ethynyl]pyridine-3-carbonyl]carbamimidoyl] 2,2,2-trifluoroethanimidate;ethane (PubChem CID 162530152) has the molecular formula C22H21F3N8O2 and a molecular weight of 486.46 g/mol. Its IUPAC name is [N'-[5-[2-(7-amino-2,3-dimethylpyrido[3,4-b]pyrazin-8-yl)ethynyl]pyridine-3-carbonyl]carbamimidoyl] 2,2,2-trifluoroethanimidate;ethane.
| Compound Name | [N'-[5-[2-(7-amino-2,3-dimethylpyrido[3,4-b]pyrazin-8-yl)ethynyl]pyridine-3-carbonyl]carbamimidoyl] 2,2,2-trifluoroethanimidate;ethane |
|---|---|
| PubChem CID | 162530152 |
| Molecular Formula | C22H21F3N8O2 |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | [N'-[5-[2-(7-amino-2,3-dimethylpyrido[3,4-b]pyrazin-8-yl)ethynyl]pyridine-3-carbonyl]carbamimidoyl] 2,2,2-trifluoroethanimidate;ethane |
| SMILES | CC.[H]/N=C(/O/C(N)=N/C(=O)c1cncc(C#Cc2c(N)ncc3nc(C)c(C)nc23)c1)C(F)(F)F |
| InChI | InChI=1S/C20H15F3N8O2.C2H6/c1-9-10(2)30-15-13(16(24)28-8-14(15)29-9)4-3-11-5-12(7-27-6-11)17(32)31-19(26)33-18(25)20(21,22)23;1-2/h5-8,25H,1-2H3,(H2,24,28)(H2,26,31,32);1-2H3/b25-18+; |
| InChIKey | QSMWJIJIAUHGCX-LHSXHHQOSA-N |
| XLogP | 3.06 |
| TPSA | 166.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|