C16H13F3N2O3 — CID 162537564
ethyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-4-pyridinyl]benzoate (PubChem CID 162537564) has the molecular formula C16H13F3N2O3 and a molecular weight of 338.29 g/mol. Its IUPAC name is ethyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-4-pyridinyl]benzoate.
| Compound Name | ethyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-4-pyridinyl]benzoate |
|---|---|
| PubChem CID | 162537564 |
| Molecular Formula | C16H13F3N2O3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | ethyl 4-[3-[(2,2,2-trifluoroacetyl)amino]-4-pyridinyl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccncc2NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H13F3N2O3/c1-2-24-14(22)11-5-3-10(4-6-11)12-7-8-20-9-13(12)21-15(23)16(17,18)19/h3-9H,2H2,1H3,(H,21,23) |
| InChIKey | SPYAVTRXJPHURA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |