C8H12F3NO5S — CID 162539305
[[1-(trifluoromethyl)cyclopentyl]oxycarbonylamino] methanesulfonate (PubChem CID 162539305) has the molecular formula C8H12F3NO5S and a molecular weight of 291.25 g/mol. Its IUPAC name is [[1-(trifluoromethyl)cyclopentyl]oxycarbonylamino] methanesulfonate.
| Compound Name | [[1-(trifluoromethyl)cyclopentyl]oxycarbonylamino] methanesulfonate |
|---|---|
| PubChem CID | 162539305 |
| Molecular Formula | C8H12F3NO5S |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | [[1-(trifluoromethyl)cyclopentyl]oxycarbonylamino] methanesulfonate |
| SMILES | CS(=O)(=O)ONC(=O)OC1(C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C8H12F3NO5S/c1-18(14,15)17-12-6(13)16-7(8(9,10)11)4-2-3-5-7/h2-5H2,1H3,(H,12,13) |
| InChIKey | CGCDEFWNPFYRLL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|