C24H17F3N2O3 — CID 162540369
8-methoxy-5-methyl-4-oxo-N-[4-(3,4,5-trifluorophenyl)phenyl]-1H-quinoline-2-carboxamide (PubChem CID 162540369) has the molecular formula C24H17F3N2O3 and a molecular weight of 438.41 g/mol. Its IUPAC name is 8-methoxy-5-methyl-4-oxo-N-[4-(3,4,5-trifluorophenyl)phenyl]-1H-quinoline-2-carboxamide.
| Compound Name | 8-methoxy-5-methyl-4-oxo-N-[4-(3,4,5-trifluorophenyl)phenyl]-1H-quinoline-2-carboxamide |
|---|---|
| PubChem CID | 162540369 |
| Molecular Formula | C24H17F3N2O3 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 8-methoxy-5-methyl-4-oxo-N-[4-(3,4,5-trifluorophenyl)phenyl]-1H-quinoline-2-carboxamide |
| SMILES | COc1ccc(C)c2c(=O)cc(C(=O)Nc3ccc(-c4cc(F)c(F)c(F)c4)cc3)[nH]c12 |
| InChI | InChI=1S/C24H17F3N2O3/c1-12-3-8-20(32-2)23-21(12)19(30)11-18(29-23)24(31)28-15-6-4-13(5-7-15)14-9-16(25)22(27)17(26)10-14/h3-11H,1-2H3,(H,28,31)(H,29,30) |
| InChIKey | AESDMDCNARBSBP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|