C21H20F3N3O2 — CID 162541195
2-methylimino-6'-[3-(trifluoromethoxy)phenyl]spiro[1,3-diazinane-6,4'-2,3-dihydro-1H-naphthalene]-4-one (PubChem CID 162541195) has the molecular formula C21H20F3N3O2 and a molecular weight of 403.40 g/mol. Its IUPAC name is 2-methylimino-6'-[3-(trifluoromethoxy)phenyl]spiro[1,3-diazinane-6,4'-2,3-dihydro-1H-naphthalene]-4-one.
| Compound Name | 2-methylimino-6'-[3-(trifluoromethoxy)phenyl]spiro[1,3-diazinane-6,4'-2,3-dihydro-1H-naphthalene]-4-one |
|---|---|
| PubChem CID | 162541195 |
| Molecular Formula | C21H20F3N3O2 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-methylimino-6'-[3-(trifluoromethoxy)phenyl]spiro[1,3-diazinane-6,4'-2,3-dihydro-1H-naphthalene]-4-one |
| SMILES | C/N=C1\NC(=O)CC2(CCCc3ccc(-c4cccc(OC(F)(F)F)c4)cc32)N1 |
| InChI | InChI=1S/C21H20F3N3O2/c1-25-19-26-18(28)12-20(27-19)9-3-5-13-7-8-15(11-17(13)20)14-4-2-6-16(10-14)29-21(22,23)24/h2,4,6-8,10-11H,3,5,9,12H2,1H3,(H2,25,26,27,28) |
| InChIKey | ZSASSTCIDJQPSR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|