C27H33F2N5O2 — CID 162544316
3-cyclohexyl-6-[3-(1,1-difluoropropyl)anilino]-1-[[4-(dimethylamino)phenyl]methyl]-1,3,5-triazine-2,4-dione (PubChem CID 162544316) has the molecular formula C27H33F2N5O2 and a molecular weight of 497.59 g/mol. Its IUPAC name is 3-cyclohexyl-6-[3-(1,1-difluoropropyl)anilino]-1-[[4-(dimethylamino)phenyl]methyl]-1,3,5-triazine-2,4-dione.
| Compound Name | 3-cyclohexyl-6-[3-(1,1-difluoropropyl)anilino]-1-[[4-(dimethylamino)phenyl]methyl]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 162544316 |
| Molecular Formula | C27H33F2N5O2 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 3-cyclohexyl-6-[3-(1,1-difluoropropyl)anilino]-1-[[4-(dimethylamino)phenyl]methyl]-1,3,5-triazine-2,4-dione |
| SMILES | CCC(F)(F)c1cccc(Nc2nc(=O)n(C3CCCCC3)c(=O)n2Cc2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C27H33F2N5O2/c1-4-27(28,29)20-9-8-10-21(17-20)30-24-31-25(35)34(23-11-6-5-7-12-23)26(36)33(24)18-19-13-15-22(16-14-19)32(2)3/h8-10,13-17,23H,4-7,11-12,18H2,1-3H3,(H,30,31,35) |
| InChIKey | QVYLJRVGSFRMOS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|