C21H22F4O2 — CID 162547687
[3-fluoro-4-(trifluoromethyl)phenoxy]-[4-(4-methylcyclohexyl)phenyl]methanol (PubChem CID 162547687) has the molecular formula C21H22F4O2 and a molecular weight of 382.40 g/mol. Its IUPAC name is [3-fluoro-4-(trifluoromethyl)phenoxy]-[4-(4-methylcyclohexyl)phenyl]methanol.
| Compound Name | [3-fluoro-4-(trifluoromethyl)phenoxy]-[4-(4-methylcyclohexyl)phenyl]methanol |
|---|---|
| PubChem CID | 162547687 |
| Molecular Formula | C21H22F4O2 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | [3-fluoro-4-(trifluoromethyl)phenoxy]-[4-(4-methylcyclohexyl)phenyl]methanol |
| SMILES | CC1CCC(c2ccc(C(O)Oc3ccc(C(F)(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C21H22F4O2/c1-13-2-4-14(5-3-13)15-6-8-16(9-7-15)20(26)27-17-10-11-18(19(22)12-17)21(23,24)25/h6-14,20,26H,2-5H2,1H3 |
| InChIKey | UHGCIXYZRDIOMW-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|