C21H17ClF3N4O4+ — CID 162550340
4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-1-methoxypyridin-1-ium-2-carboxamide (PubChem CID 162550340) has the molecular formula C21H17ClF3N4O4+ and a molecular weight of 481.84 g/mol. Its IUPAC name is 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-1-methoxypyridin-1-ium-2-carboxamide.
| Compound Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-1-methoxypyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 162550340 |
| Molecular Formula | C21H17ClF3N4O4+ |
| Molecular Weight | 481.84 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-1-methoxypyridin-1-ium-2-carboxamide |
| SMILES | CO[n+]1ccc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)cc1C(N)=O |
| InChI | InChI=1S/C21H16ClF3N4O4/c1-32-29-9-8-15(11-18(29)19(26)30)33-14-5-2-12(3-6-14)27-20(31)28-13-4-7-17(22)16(10-13)21(23,24)25/h2-11H,1H3,(H3-,26,27,28,30,31)/p+1 |
| InChIKey | WJLOJPHCOQDPOG-UHFFFAOYSA-O |
| XLogP | 4.24 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.84 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|