C27H28BrF6NO2 — CID 162550933
propan-2-yl 5-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-7-bromo-3,4,5,8,9,10-hexahydro-2H-cyclopenta[i][1]benzazepine-1-carboxylate (PubChem CID 162550933) has the molecular formula C27H28BrF6NO2 and a molecular weight of 592.42 g/mol. Its IUPAC name is propan-2-yl 5-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-7-bromo-3,4,5,8,9,10-hexahydro-2H-cyclopenta[i][1]benzazepine-1-carboxylate.
| Compound Name | propan-2-yl 5-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-7-bromo-3,4,5,8,9,10-hexahydro-2H-cyclopenta[i][1]benzazepine-1-carboxylate |
|---|---|
| PubChem CID | 162550933 |
| Molecular Formula | C27H28BrF6NO2 |
| Molecular Weight | 592.42 g/mol |
| Exact Mass | 591.12 |
| IUPAC Name | propan-2-yl 5-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]-7-bromo-3,4,5,8,9,10-hexahydro-2H-cyclopenta[i][1]benzazepine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CCCC(CCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(Br)c3c(c21)CCC3 |
| InChI | InChI=1S/C27H28BrF6NO2/c1-15(2)37-25(36)35-10-4-5-17(22-14-23(28)20-6-3-7-21(20)24(22)35)9-8-16-11-18(26(29,30)31)13-19(12-16)27(32,33)34/h11-15,17H,3-10H2,1-2H3 |
| InChIKey | VJTPWFFXTDBDLS-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.42 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |