C16H15ClF4N2O2 — CID 162553487
(3S)-3-amino-3-(5-chloro-2-pyridinyl)-3-[3-fluoro-5-(trifluoromethyl)phenyl]-1-methoxypropan-1-ol (PubChem CID 162553487) has the molecular formula C16H15ClF4N2O2 and a molecular weight of 378.75 g/mol. Its IUPAC name is (3S)-3-amino-3-(5-chloro-2-pyridinyl)-3-[3-fluoro-5-(trifluoromethyl)phenyl]-1-methoxypropan-1-ol.
| Compound Name | (3S)-3-amino-3-(5-chloro-2-pyridinyl)-3-[3-fluoro-5-(trifluoromethyl)phenyl]-1-methoxypropan-1-ol |
|---|---|
| PubChem CID | 162553487 |
| Molecular Formula | C16H15ClF4N2O2 |
| Molecular Weight | 378.75 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (3S)-3-amino-3-(5-chloro-2-pyridinyl)-3-[3-fluoro-5-(trifluoromethyl)phenyl]-1-methoxypropan-1-ol |
| SMILES | COC(O)C[C@](N)(c1cc(F)cc(C(F)(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C16H15ClF4N2O2/c1-25-14(24)7-15(22,13-3-2-11(17)8-23-13)9-4-10(16(19,20)21)6-12(18)5-9/h2-6,8,14,24H,7,22H2,1H3/t14?,15-/m0/s1 |
| InChIKey | VBLXOUVITAFGMY-LOACHALJSA-N |
| XLogP | 3.45 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.75 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|