C22H21F3IN5O2S — CID 162553985
5-[2-[[3-(iodoamino)-4-[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]butyl]amino]-1,3-thiazol-5-yl]-2,3-dihydroisoindol-1-one (PubChem CID 162553985) has the molecular formula C22H21F3IN5O2S and a molecular weight of 603.41 g/mol. Its IUPAC name is 5-[2-[[3-(iodoamino)-4-[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]butyl]amino]-1,3-thiazol-5-yl]-2,3-dihydroisoindol-1-one.
| Compound Name | 5-[2-[[3-(iodoamino)-4-[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]butyl]amino]-1,3-thiazol-5-yl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 162553985 |
| Molecular Formula | C22H21F3IN5O2S |
| Molecular Weight | 603.41 g/mol |
| Exact Mass | 603.04 |
| IUPAC Name | 5-[2-[[3-(iodoamino)-4-[5-methoxy-6-(trifluoromethyl)-3-pyridinyl]butyl]amino]-1,3-thiazol-5-yl]-2,3-dihydroisoindol-1-one |
| SMILES | COc1cc(CC(CCNc2ncc(-c3ccc4c(c3)CNC4=O)s2)NI)cnc1C(F)(F)F |
| InChI | InChI=1S/C22H21F3IN5O2S/c1-33-17-7-12(9-28-19(17)22(23,24)25)6-15(31-26)4-5-27-21-30-11-18(34-21)13-2-3-16-14(8-13)10-29-20(16)32/h2-3,7-9,11,15,31H,4-6,10H2,1H3,(H,27,30)(H,29,32) |
| InChIKey | ZHBFCPWJXFGURV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|