C16H14F9N5O2S — CID 162556430
[[4,6-bis(2,2,2-trifluoroethoxy)pyrimidin-2-yl]amino]-[methyl-[6-(trifluoromethyl)-3-pyridinyl]amino]methanethiol (PubChem CID 162556430) has the molecular formula C16H14F9N5O2S and a molecular weight of 511.37 g/mol. Its IUPAC name is [[4,6-bis(2,2,2-trifluoroethoxy)pyrimidin-2-yl]amino]-[methyl-[6-(trifluoromethyl)-3-pyridinyl]amino]methanethiol.
| Compound Name | [[4,6-bis(2,2,2-trifluoroethoxy)pyrimidin-2-yl]amino]-[methyl-[6-(trifluoromethyl)-3-pyridinyl]amino]methanethiol |
|---|---|
| PubChem CID | 162556430 |
| Molecular Formula | C16H14F9N5O2S |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | [[4,6-bis(2,2,2-trifluoroethoxy)pyrimidin-2-yl]amino]-[methyl-[6-(trifluoromethyl)-3-pyridinyl]amino]methanethiol |
| SMILES | CN(c1ccc(C(F)(F)F)nc1)C(S)Nc1nc(OCC(F)(F)F)cc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C16H14F9N5O2S/c1-30(8-2-3-9(26-5-8)16(23,24)25)13(33)29-12-27-10(31-6-14(17,18)19)4-11(28-12)32-7-15(20,21)22/h2-5,13,33H,6-7H2,1H3,(H,27,28,29) |
| InChIKey | ALIAXBVCFVYZTN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|