C17H13F9N4O3S — CID 87382535
3-[4,6-bis(2,2,2-trifluoroethoxy)pyrimidin-2-yl]-1-methyl-1-[4-(trifluoromethyl)phenyl]sulfanylurea (PubChem CID 87382535) has the molecular formula C17H13F9N4O3S and a molecular weight of 524.37 g/mol. Its IUPAC name is 3-[4,6-bis(2,2,2-trifluoroethoxy)pyrimidin-2-yl]-1-methyl-1-[4-(trifluoromethyl)phenyl]sulfanylurea.
| Compound Name | 3-[4,6-bis(2,2,2-trifluoroethoxy)pyrimidin-2-yl]-1-methyl-1-[4-(trifluoromethyl)phenyl]sulfanylurea |
|---|---|
| PubChem CID | 87382535 |
| Molecular Formula | C17H13F9N4O3S |
| Molecular Weight | 524.37 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | 3-[4,6-bis(2,2,2-trifluoroethoxy)pyrimidin-2-yl]-1-methyl-1-[4-(trifluoromethyl)phenyl]sulfanylurea |
| SMILES | CN(Sc1ccc(C(F)(F)F)cc1)C(=O)Nc1nc(OCC(F)(F)F)cc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C17H13F9N4O3S/c1-30(34-10-4-2-9(3-5-10)17(24,25)26)14(31)29-13-27-11(32-7-15(18,19)20)6-12(28-13)33-8-16(21,22)23/h2-6H,7-8H2,1H3,(H,27,28,29,31) |
| InChIKey | NEBMISVPJRBTSG-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.37 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|