C16H16F6N5O4P — CID 143790021
1-[4-[hydroxy(methoxy)amino]phenyl]-3-[4-(2,2,2-trifluoroethoxy)-6-(2,2,2-trifluoroethylphosphanyl)pyrimidin-2-yl]urea (PubChem CID 143790021) has the molecular formula C16H16F6N5O4P and a molecular weight of 487.30 g/mol. Its IUPAC name is 1-[4-[hydroxy(methoxy)amino]phenyl]-3-[4-(2,2,2-trifluoroethoxy)-6-(2,2,2-trifluoroethylphosphanyl)pyrimidin-2-yl]urea.
| Compound Name | 1-[4-[hydroxy(methoxy)amino]phenyl]-3-[4-(2,2,2-trifluoroethoxy)-6-(2,2,2-trifluoroethylphosphanyl)pyrimidin-2-yl]urea |
|---|---|
| PubChem CID | 143790021 |
| Molecular Formula | C16H16F6N5O4P |
| Molecular Weight | 487.30 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | 1-[4-[hydroxy(methoxy)amino]phenyl]-3-[4-(2,2,2-trifluoroethoxy)-6-(2,2,2-trifluoroethylphosphanyl)pyrimidin-2-yl]urea |
| SMILES | CON(O)c1ccc(NC(=O)Nc2nc(OCC(F)(F)F)cc(PCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C16H16F6N5O4P/c1-30-27(29)10-4-2-9(3-5-10)23-14(28)26-13-24-11(31-7-15(17,18)19)6-12(25-13)32-8-16(20,21)22/h2-6,29,32H,7-8H2,1H3,(H2,23,24,25,26,28) |
| InChIKey | FWQOMMMTWSCKAN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 108.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|