C17H14F6N2O4 — CID 154841148
1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4-hydroxyphenyl)urea (PubChem CID 154841148) has the molecular formula C17H14F6N2O4 and a molecular weight of 424.30 g/mol. Its IUPAC name is 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4-hydroxyphenyl)urea.
| Compound Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 154841148 |
| Molecular Formula | C17H14F6N2O4 |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4-hydroxyphenyl)urea |
| SMILES | O=C(Nc1ccc(O)cc1)Nc1cc(OCC(F)(F)F)cc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F6N2O4/c18-16(19,20)8-28-13-5-11(6-14(7-13)29-9-17(21,22)23)25-15(27)24-10-1-3-12(26)4-2-10/h1-7,26H,8-9H2,(H2,24,25,27) |
| InChIKey | APYGTCDHDRFTGZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|