C17H18F6N4O3 — CID 167812027
1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(5-ethyl-1-methylpyrazol-3-yl)urea (PubChem CID 167812027) has the molecular formula C17H18F6N4O3 and a molecular weight of 440.34 g/mol. Its IUPAC name is 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(5-ethyl-1-methylpyrazol-3-yl)urea.
| Compound Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(5-ethyl-1-methylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 167812027 |
| Molecular Formula | C17H18F6N4O3 |
| Molecular Weight | 440.34 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(5-ethyl-1-methylpyrazol-3-yl)urea |
| SMILES | CCc1cc(NC(=O)Nc2cc(OCC(F)(F)F)cc(OCC(F)(F)F)c2)nn1C |
| InChI | InChI=1S/C17H18F6N4O3/c1-3-11-6-14(26-27(11)2)25-15(28)24-10-4-12(29-8-16(18,19)20)7-13(5-10)30-9-17(21,22)23/h4-7H,3,8-9H2,1-2H3,(H2,24,25,26,28) |
| InChIKey | MQQFALJWJLEXJR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |