C16H18F6N2O3 — CID 154837038
1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(2-methylcyclobutyl)urea (PubChem CID 154837038) has the molecular formula C16H18F6N2O3 and a molecular weight of 400.32 g/mol. Its IUPAC name is 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(2-methylcyclobutyl)urea.
| Compound Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(2-methylcyclobutyl)urea |
|---|---|
| PubChem CID | 154837038 |
| Molecular Formula | C16H18F6N2O3 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(2-methylcyclobutyl)urea |
| SMILES | CC1CCC1NC(=O)Nc1cc(OCC(F)(F)F)cc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C16H18F6N2O3/c1-9-2-3-13(9)24-14(25)23-10-4-11(26-7-15(17,18)19)6-12(5-10)27-8-16(20,21)22/h4-6,9,13H,2-3,7-8H2,1H3,(H2,23,24,25) |
| InChIKey | PIBRIGMTYATLBP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |