C17H18F6N2O3 — CID 154851873
1-[(1R,5R)-1-bicyclo[3.1.0]hexanyl]-3-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]urea (PubChem CID 154851873) has the molecular formula C17H18F6N2O3 and a molecular weight of 412.33 g/mol. Its IUPAC name is 1-[(1R,5R)-1-bicyclo[3.1.0]hexanyl]-3-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]urea.
| Compound Name | 1-[(1R,5R)-1-bicyclo[3.1.0]hexanyl]-3-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]urea |
|---|---|
| PubChem CID | 154851873 |
| Molecular Formula | C17H18F6N2O3 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 1-[(1R,5R)-1-bicyclo[3.1.0]hexanyl]-3-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]urea |
| SMILES | O=C(Nc1cc(OCC(F)(F)F)cc(OCC(F)(F)F)c1)N[C@@]12CCC[C@@H]1C2 |
| InChI | InChI=1S/C17H18F6N2O3/c18-16(19,20)8-27-12-4-11(5-13(6-12)28-9-17(21,22)23)24-14(26)25-15-3-1-2-10(15)7-15/h4-6,10H,1-3,7-9H2,(H2,24,25,26)/t10-,15-/m1/s1 |
| InChIKey | PFWNODBBTSOMNA-MEBBXXQBSA-N |
| XLogP | 4.63 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |