C18H16F6N2O3 — CID 2327387
1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4-methylphenyl)urea (PubChem CID 2327387) has the molecular formula C18H16F6N2O3 and a molecular weight of 422.33 g/mol. Its IUPAC name is 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 2327387 |
| Molecular Formula | C18H16F6N2O3 |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cc(OCC(F)(F)F)cc(OCC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H16F6N2O3/c1-11-2-4-12(5-3-11)25-16(27)26-13-6-14(28-9-17(19,20)21)8-15(7-13)29-10-18(22,23)24/h2-8H,9-10H2,1H3,(H2,25,26,27) |
| InChIKey | UIODLUKTRRMRAR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |