C14H10BrF5IN5O3 — CID 162556424
1-(4-bromophenyl)-3-[4-(2,2-difluoro-2-iodoethoxy)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]urea (PubChem CID 162556424) has the molecular formula C14H10BrF5IN5O3 and a molecular weight of 598.06 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[4-(2,2-difluoro-2-iodoethoxy)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]urea.
| Compound Name | 1-(4-bromophenyl)-3-[4-(2,2-difluoro-2-iodoethoxy)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]urea |
|---|---|
| PubChem CID | 162556424 |
| Molecular Formula | C14H10BrF5IN5O3 |
| Molecular Weight | 598.06 g/mol |
| Exact Mass | 596.89 |
| IUPAC Name | 1-(4-bromophenyl)-3-[4-(2,2-difluoro-2-iodoethoxy)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]urea |
| SMILES | O=C(Nc1ccc(Br)cc1)Nc1nc(OCC(F)(F)F)nc(OCC(F)(F)I)n1 |
| InChI | InChI=1S/C14H10BrF5IN5O3/c15-7-1-3-8(4-2-7)22-10(27)23-9-24-11(28-5-13(16,17)18)26-12(25-9)29-6-14(19,20)21/h1-4H,5-6H2,(H2,22,23,24,25,26,27) |
| InChIKey | GSECMLZGCHOMKU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.06 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|