C35H34F10O4 — CID 162558587
[4-[1,1,1,3,3,3-hexafluoro-2-[4-(2-methylbutan-2-yloxy)phenyl]propan-2-yl]phenyl] 2-[4-(1,1-difluoro-3,3-dimethyl-2-oxopentyl)phenyl]-2,2-difluoroacetate (PubChem CID 162558587) has the molecular formula C35H34F10O4 and a molecular weight of 708.63 g/mol. Its IUPAC name is [4-[1,1,1,3,3,3-hexafluoro-2-[4-(2-methylbutan-2-yloxy)phenyl]propan-2-yl]phenyl] 2-[4-(1,1-difluoro-3,3-dimethyl-2-oxopentyl)phenyl]-2,2-difluoroacetate.
| Compound Name | [4-[1,1,1,3,3,3-hexafluoro-2-[4-(2-methylbutan-2-yloxy)phenyl]propan-2-yl]phenyl] 2-[4-(1,1-difluoro-3,3-dimethyl-2-oxopentyl)phenyl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 162558587 |
| Molecular Formula | C35H34F10O4 |
| Molecular Weight | 708.63 g/mol |
| Exact Mass | 708.23 |
| IUPAC Name | [4-[1,1,1,3,3,3-hexafluoro-2-[4-(2-methylbutan-2-yloxy)phenyl]propan-2-yl]phenyl] 2-[4-(1,1-difluoro-3,3-dimethyl-2-oxopentyl)phenyl]-2,2-difluoroacetate |
| SMILES | CCC(C)(C)Oc1ccc(C(c2ccc(OC(=O)C(F)(F)c3ccc(C(F)(F)C(=O)C(C)(C)CC)cc3)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C35H34F10O4/c1-7-29(3,4)27(46)32(36,37)23-9-11-24(12-10-23)33(38,39)28(47)48-25-17-13-21(14-18-25)31(34(40,41)42,35(43,44)45)22-15-19-26(20-16-22)49-30(5,6)8-2/h9-20H,7-8H2,1-6H3 |
| InChIKey | XUKVMMZLRSEUCB-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.63 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|