C22H21F2N3O2S — CID 162559923
5-[5-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazol-3-yl]-N-(2-phenoxyethyl)thiophene-2-carboxamide (PubChem CID 162559923) has the molecular formula C22H21F2N3O2S and a molecular weight of 429.49 g/mol. Its IUPAC name is 5-[5-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazol-3-yl]-N-(2-phenoxyethyl)thiophene-2-carboxamide.
| Compound Name | 5-[5-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazol-3-yl]-N-(2-phenoxyethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 162559923 |
| Molecular Formula | C22H21F2N3O2S |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 5-[5-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazol-3-yl]-N-(2-phenoxyethyl)thiophene-2-carboxamide |
| SMILES | C=CCn1nc(-c2ccc(C(=O)NCCOc3ccccc3)s2)cc1C(F)(F)C=C |
| InChI | InChI=1S/C22H21F2N3O2S/c1-3-13-27-20(22(23,24)4-2)15-17(26-27)18-10-11-19(30-18)21(28)25-12-14-29-16-8-6-5-7-9-16/h3-11,15H,1-2,12-14H2,(H,25,28) |
| InChIKey | PGOBQQJZQAZFAQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|