C19H22F3N3O6 — CID 162562267
1-O-tert-butyl 3-O-methyl 4-[[(4,4,4-trifluoro-1,1-dihydroxybutan-2-ylidene)amino]methyl]pyrrolo[2,3-b]pyridine-1,3-dicarboxylate (PubChem CID 162562267) has the molecular formula C19H22F3N3O6 and a molecular weight of 445.39 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl 4-[[(4,4,4-trifluoro-1,1-dihydroxybutan-2-ylidene)amino]methyl]pyrrolo[2,3-b]pyridine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl 4-[[(4,4,4-trifluoro-1,1-dihydroxybutan-2-ylidene)amino]methyl]pyrrolo[2,3-b]pyridine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 162562267 |
| Molecular Formula | C19H22F3N3O6 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl 4-[[(4,4,4-trifluoro-1,1-dihydroxybutan-2-ylidene)amino]methyl]pyrrolo[2,3-b]pyridine-1,3-dicarboxylate |
| SMILES | COC(=O)c1cn(C(=O)OC(C)(C)C)c2nccc(C/N=C(\CC(F)(F)F)C(O)O)c12 |
| InChI | InChI=1S/C19H22F3N3O6/c1-18(2,3)31-17(29)25-9-11(16(28)30-4)13-10(5-6-23-14(13)25)8-24-12(15(26)27)7-19(20,21)22/h5-6,9,15,26-27H,7-8H2,1-4H3/b24-12+ |
| InChIKey | SVNSTTRKKQDLPN-WYMPLXKRSA-N |
| XLogP | 2.81 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|