C14H16F3N2O2+ — CID 162564669
4,4-diethyl-2-[2-(trifluoromethoxy)phenyl]-1H-imidazol-3-ium-5-one (PubChem CID 162564669) has the molecular formula C14H16F3N2O2+ and a molecular weight of 301.29 g/mol. Its IUPAC name is 4,4-diethyl-2-[2-(trifluoromethoxy)phenyl]-1H-imidazol-3-ium-5-one.
| Compound Name | 4,4-diethyl-2-[2-(trifluoromethoxy)phenyl]-1H-imidazol-3-ium-5-one |
|---|---|
| PubChem CID | 162564669 |
| Molecular Formula | C14H16F3N2O2+ |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 4,4-diethyl-2-[2-(trifluoromethoxy)phenyl]-1H-imidazol-3-ium-5-one |
| SMILES | CCC1(CC)[NH+]=C(c2ccccc2OC(F)(F)F)NC1=O |
| InChI | InChI=1S/C14H15F3N2O2/c1-3-13(4-2)12(20)18-11(19-13)9-7-5-6-8-10(9)21-14(15,16)17/h5-8H,3-4H2,1-2H3,(H,18,19,20)/p+1 |
| InChIKey | LYKWOYFJRXFNEQ-UHFFFAOYSA-O |
| XLogP | 1.10 |
| TPSA | 52.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |