C27H25F3INO5 — CID 162565715
methyl 15-(acetyloxymethyl)-10-iodo-7-phenylmethoxy-4-(trifluoromethyl)-5-azatetracyclo[7.6.0.02,6.011,13]pentadeca-1,3,6,8-tetraene-3-carboxylate (PubChem CID 162565715) has the molecular formula C27H25F3INO5 and a molecular weight of 627.40 g/mol. Its IUPAC name is methyl 15-(acetyloxymethyl)-10-iodo-7-phenylmethoxy-4-(trifluoromethyl)-5-azatetracyclo[7.6.0.02,6.011,13]pentadeca-1,3,6,8-tetraene-3-carboxylate.
| Compound Name | methyl 15-(acetyloxymethyl)-10-iodo-7-phenylmethoxy-4-(trifluoromethyl)-5-azatetracyclo[7.6.0.02,6.011,13]pentadeca-1,3,6,8-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 162565715 |
| Molecular Formula | C27H25F3INO5 |
| Molecular Weight | 627.40 g/mol |
| Exact Mass | 627.07 |
| IUPAC Name | methyl 15-(acetyloxymethyl)-10-iodo-7-phenylmethoxy-4-(trifluoromethyl)-5-azatetracyclo[7.6.0.02,6.011,13]pentadeca-1,3,6,8-tetraene-3-carboxylate |
| SMILES | COC(=O)c1c(C(F)(F)F)[nH]c2c(OCc3ccccc3)cc3c(c12)C(COC(C)=O)CC1CC1C3I |
| InChI | InChI=1S/C27H25F3INO5/c1-13(33)36-12-16-8-15-9-17(15)23(31)18-10-19(37-11-14-6-4-3-5-7-14)24-21(20(16)18)22(26(34)35-2)25(32-24)27(28,29)30/h3-7,10,15-17,23,32H,8-9,11-12H2,1-2H3 |
| InChIKey | XIJDHCKKNZRUIT-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.40 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|