C10H17F3N2O3 — CID 162566784
tert-butyl N-(3-nitrosopropyl)-N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 162566784) has the molecular formula C10H17F3N2O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is tert-butyl N-(3-nitrosopropyl)-N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | tert-butyl N-(3-nitrosopropyl)-N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 162566784 |
| Molecular Formula | C10H17F3N2O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | tert-butyl N-(3-nitrosopropyl)-N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCN=O)CC(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O3/c1-9(2,3)18-8(16)15(6-4-5-14-17)7-10(11,12)13/h4-7H2,1-3H3 |
| InChIKey | WLFBOACTDOSSNW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|