C20H17F5N4O3 — CID 162570518
N-(3-cyano-4-fluorophenyl)-3-fluoro-1-methyl-4-[2-[[[1-(trifluoromethyl)cyclopropyl]amino]methoxy]acetyl]pyrrole-2-carboxamide (PubChem CID 162570518) has the molecular formula C20H17F5N4O3 and a molecular weight of 456.37 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)-3-fluoro-1-methyl-4-[2-[[[1-(trifluoromethyl)cyclopropyl]amino]methoxy]acetyl]pyrrole-2-carboxamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)-3-fluoro-1-methyl-4-[2-[[[1-(trifluoromethyl)cyclopropyl]amino]methoxy]acetyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 162570518 |
| Molecular Formula | C20H17F5N4O3 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)-3-fluoro-1-methyl-4-[2-[[[1-(trifluoromethyl)cyclopropyl]amino]methoxy]acetyl]pyrrole-2-carboxamide |
| SMILES | Cn1cc(C(=O)COCNC2(C(F)(F)F)CC2)c(F)c1C(=O)Nc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C20H17F5N4O3/c1-29-8-13(15(30)9-32-10-27-19(4-5-19)20(23,24)25)16(22)17(29)18(31)28-12-2-3-14(21)11(6-12)7-26/h2-3,6,8,27H,4-5,9-10H2,1H3,(H,28,31) |
| InChIKey | YBLUEKKTEIGBCR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|