C26H15BF14N3+ — CID 162575893
[(3Z)-2-[cyano-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]boranyl]-3-[cyano-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]methylidene]cyclopropen-1-yl]-triethylazanium (PubChem CID 162575893) has the molecular formula C26H15BF14N3+ and a molecular weight of 646.21 g/mol. Its IUPAC name is [(3Z)-2-[cyano-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]boranyl]-3-[cyano-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]methylidene]cyclopropen-1-yl]-triethylazanium.
| Compound Name | [(3Z)-2-[cyano-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]boranyl]-3-[cyano-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]methylidene]cyclopropen-1-yl]-triethylazanium |
|---|---|
| PubChem CID | 162575893 |
| Molecular Formula | C26H15BF14N3+ |
| Molecular Weight | 646.21 g/mol |
| Exact Mass | 646.11 |
| IUPAC Name | [(3Z)-2-[cyano-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]boranyl]-3-[cyano-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]methylidene]cyclopropen-1-yl]-triethylazanium |
| SMILES | CC[N+](CC)(CC)C1=C(B(C#N)c2c(F)c(F)c(C(F)(F)F)c(F)c2F)/C1=C(/C#N)c1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C26H15BF14N3/c1-4-44(5-2,6-3)24-10(9(7-42)11-16(28)18(30)12(25(36,37)38)19(31)17(11)29)14(24)27(8-43)15-22(34)20(32)13(26(39,40)41)21(33)23(15)35/h4-6H2,1-3H3/q+1/b10-9+ |
| InChIKey | IOGOTHJSNPZWNM-MDZDMXLPSA-N |
| XLogP | 7.26 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.21 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|