C21H19ClF3NO2S — CID 162577038
4-chloro-2-[(2S)-4-cyclopropyl-1,1,1-trifluoro-2-sulfanyloxybut-3-yn-2-yl]-N-[(4-methoxyphenyl)methyl]aniline (PubChem CID 162577038) has the molecular formula C21H19ClF3NO2S and a molecular weight of 441.90 g/mol. Its IUPAC name is 4-chloro-2-[(2S)-4-cyclopropyl-1,1,1-trifluoro-2-sulfanyloxybut-3-yn-2-yl]-N-[(4-methoxyphenyl)methyl]aniline.
| Compound Name | 4-chloro-2-[(2S)-4-cyclopropyl-1,1,1-trifluoro-2-sulfanyloxybut-3-yn-2-yl]-N-[(4-methoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 162577038 |
| Molecular Formula | C21H19ClF3NO2S |
| Molecular Weight | 441.90 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 4-chloro-2-[(2S)-4-cyclopropyl-1,1,1-trifluoro-2-sulfanyloxybut-3-yn-2-yl]-N-[(4-methoxyphenyl)methyl]aniline |
| SMILES | COc1ccc(CNc2ccc(Cl)cc2[C@](C#CC2CC2)(OS)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19ClF3NO2S/c1-27-17-7-4-15(5-8-17)13-26-19-9-6-16(22)12-18(19)20(28-29,21(23,24)25)11-10-14-2-3-14/h4-9,12,14,26,29H,2-3,13H2,1H3/t20-/m0/s1 |
| InChIKey | XNDIGEJFXDIQMY-FQEVSTJZSA-N |
| XLogP | 5.99 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.90 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|