C22H21ClF3NO — CID 15449197
2-[5-chloro-2-(2-phenylpropan-2-ylamino)phenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol (PubChem CID 15449197) has the molecular formula C22H21ClF3NO and a molecular weight of 407.86 g/mol. Its IUPAC name is 2-[5-chloro-2-(2-phenylpropan-2-ylamino)phenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol.
| Compound Name | 2-[5-chloro-2-(2-phenylpropan-2-ylamino)phenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol |
|---|---|
| PubChem CID | 15449197 |
| Molecular Formula | C22H21ClF3NO |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 2-[5-chloro-2-(2-phenylpropan-2-ylamino)phenyl]-4-cyclopropyl-1,1,1-trifluorobut-3-yn-2-ol |
| SMILES | CC(C)(Nc1ccc(Cl)cc1C(O)(C#CC1CC1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C22H21ClF3NO/c1-20(2,16-6-4-3-5-7-16)27-19-11-10-17(23)14-18(19)21(28,22(24,25)26)13-12-15-8-9-15/h3-7,10-11,14-15,27-28H,8-9H2,1-2H3 |
| InChIKey | UOUCZPVIGVTPEK-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|