C34H27ClF3NO4 — CID 10941045
ethyl 4-acetyloxy-4-[5-chloro-2-(tritylamino)phenyl]-5,5,5-trifluoropent-2-ynoate (PubChem CID 10941045) has the molecular formula C34H27ClF3NO4 and a molecular weight of 606.04 g/mol. Its IUPAC name is ethyl 4-acetyloxy-4-[5-chloro-2-(tritylamino)phenyl]-5,5,5-trifluoropent-2-ynoate.
| Compound Name | ethyl 4-acetyloxy-4-[5-chloro-2-(tritylamino)phenyl]-5,5,5-trifluoropent-2-ynoate |
|---|---|
| PubChem CID | 10941045 |
| Molecular Formula | C34H27ClF3NO4 |
| Molecular Weight | 606.04 g/mol |
| Exact Mass | 605.16 |
| IUPAC Name | ethyl 4-acetyloxy-4-[5-chloro-2-(tritylamino)phenyl]-5,5,5-trifluoropent-2-ynoate |
| SMILES | CCOC(=O)C#CC(OC(C)=O)(c1cc(Cl)ccc1NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C34H27ClF3NO4/c1-3-42-31(41)21-22-32(34(36,37)38,43-24(2)40)29-23-28(35)19-20-30(29)39-33(25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27/h4-20,23,39H,3H2,1-2H3 |
| InChIKey | APENYOQFUYUABY-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.04 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|