C21H21ClF3NO2 — CID 70160226
2-[5-chloro-2-[(4-methoxyphenyl)methylamino]phenyl]-3-cyclopropyl-1,1,1-trifluorobut-3-en-2-ol (PubChem CID 70160226) has the molecular formula C21H21ClF3NO2 and a molecular weight of 411.85 g/mol. Its IUPAC name is 2-[5-chloro-2-[(4-methoxyphenyl)methylamino]phenyl]-3-cyclopropyl-1,1,1-trifluorobut-3-en-2-ol.
| Compound Name | 2-[5-chloro-2-[(4-methoxyphenyl)methylamino]phenyl]-3-cyclopropyl-1,1,1-trifluorobut-3-en-2-ol |
|---|---|
| PubChem CID | 70160226 |
| Molecular Formula | C21H21ClF3NO2 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2-[5-chloro-2-[(4-methoxyphenyl)methylamino]phenyl]-3-cyclopropyl-1,1,1-trifluorobut-3-en-2-ol |
| SMILES | C=C(C1CC1)C(O)(c1cc(Cl)ccc1NCc1ccc(OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C21H21ClF3NO2/c1-13(15-5-6-15)20(27,21(23,24)25)18-11-16(22)7-10-19(18)26-12-14-3-8-17(28-2)9-4-14/h3-4,7-11,15,26-27H,1,5-6,12H2,2H3 |
| InChIKey | AHVFINMFAYIBKR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|