C18H17F3N2O4S — CID 162578812
N-[(1-hydroxy-2-oxopyrrolidin-3-yl)methyl]-4-[4-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 162578812) has the molecular formula C18H17F3N2O4S and a molecular weight of 414.41 g/mol. Its IUPAC name is N-[(1-hydroxy-2-oxopyrrolidin-3-yl)methyl]-4-[4-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | N-[(1-hydroxy-2-oxopyrrolidin-3-yl)methyl]-4-[4-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 162578812 |
| Molecular Formula | C18H17F3N2O4S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | N-[(1-hydroxy-2-oxopyrrolidin-3-yl)methyl]-4-[4-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | O=C1C(CNS(=O)(=O)c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)CCN1O |
| InChI | InChI=1S/C18H17F3N2O4S/c19-18(20,21)15-5-1-12(2-6-15)13-3-7-16(8-4-13)28(26,27)22-11-14-9-10-23(25)17(14)24/h1-8,14,22,25H,9-11H2 |
| InChIKey | KWIQNZPCIWEFTH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|