C21H24F3N3O2S — CID 162582659
4-[4-[3-(4,4-difluoropiperidin-1-yl)pyrrolidin-1-yl]sulfonyl-2-fluorophenyl]aniline (PubChem CID 162582659) has the molecular formula C21H24F3N3O2S and a molecular weight of 439.50 g/mol. Its IUPAC name is 4-[4-[3-(4,4-difluoropiperidin-1-yl)pyrrolidin-1-yl]sulfonyl-2-fluorophenyl]aniline.
| Compound Name | 4-[4-[3-(4,4-difluoropiperidin-1-yl)pyrrolidin-1-yl]sulfonyl-2-fluorophenyl]aniline |
|---|---|
| PubChem CID | 162582659 |
| Molecular Formula | C21H24F3N3O2S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 4-[4-[3-(4,4-difluoropiperidin-1-yl)pyrrolidin-1-yl]sulfonyl-2-fluorophenyl]aniline |
| SMILES | Nc1ccc(-c2ccc(S(=O)(=O)N3CCC(N4CCC(F)(F)CC4)C3)cc2F)cc1 |
| InChI | InChI=1S/C21H24F3N3O2S/c22-20-13-18(5-6-19(20)15-1-3-16(25)4-2-15)30(28,29)27-10-7-17(14-27)26-11-8-21(23,24)9-12-26/h1-6,13,17H,7-12,14,25H2 |
| InChIKey | PJYMGORZNDIHCI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|