C23H26F3N3O2S — CID 143369577
N-[[4-[4-(3-pyrrolidin-1-ylpyrrolidin-1-yl)sulfonyl-2-(trifluoromethyl)phenyl]phenyl]methyl]methanimine (PubChem CID 143369577) has the molecular formula C23H26F3N3O2S and a molecular weight of 465.54 g/mol. Its IUPAC name is N-[[4-[4-(3-pyrrolidin-1-ylpyrrolidin-1-yl)sulfonyl-2-(trifluoromethyl)phenyl]phenyl]methyl]methanimine.
| Compound Name | N-[[4-[4-(3-pyrrolidin-1-ylpyrrolidin-1-yl)sulfonyl-2-(trifluoromethyl)phenyl]phenyl]methyl]methanimine |
|---|---|
| PubChem CID | 143369577 |
| Molecular Formula | C23H26F3N3O2S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N-[[4-[4-(3-pyrrolidin-1-ylpyrrolidin-1-yl)sulfonyl-2-(trifluoromethyl)phenyl]phenyl]methyl]methanimine |
| SMILES | C=NCc1ccc(-c2ccc(S(=O)(=O)N3CCC(N4CCCC4)C3)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H26F3N3O2S/c1-27-15-17-4-6-18(7-5-17)21-9-8-20(14-22(21)23(24,25)26)32(30,31)29-13-10-19(16-29)28-11-2-3-12-28/h4-9,14,19H,1-3,10-13,15-16H2 |
| InChIKey | LREXFDNFFPJIFV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|