C22H20Cl2F3N5O3 — CID 162584154
N-[[1-[2-(2,4-dichlorophenyl)-6-oxo-1-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]pyrrolidin-3-yl]amino]-N-hydroxymethanamine oxide (PubChem CID 162584154) has the molecular formula C22H20Cl2F3N5O3 and a molecular weight of 530.33 g/mol. Its IUPAC name is N-[[1-[2-(2,4-dichlorophenyl)-6-oxo-1-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]pyrrolidin-3-yl]amino]-N-hydroxymethanamine oxide.
| Compound Name | N-[[1-[2-(2,4-dichlorophenyl)-6-oxo-1-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]pyrrolidin-3-yl]amino]-N-hydroxymethanamine oxide |
|---|---|
| PubChem CID | 162584154 |
| Molecular Formula | C22H20Cl2F3N5O3 |
| Molecular Weight | 530.33 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | N-[[1-[2-(2,4-dichlorophenyl)-6-oxo-1-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]pyrrolidin-3-yl]amino]-N-hydroxymethanamine oxide |
| SMILES | C[N+]([O-])(O)NC1CCN(c2cc(=O)n(-c3ccc(C(F)(F)F)cc3)c(-c3ccc(Cl)cc3Cl)n2)C1 |
| InChI | InChI=1S/C22H20Cl2F3N5O3/c1-32(34,35)29-15-8-9-30(12-15)19-11-20(33)31(16-5-2-13(3-6-16)22(25,26)27)21(28-19)17-7-4-14(23)10-18(17)24/h2-7,10-11,15,29,34H,8-9,12H2,1H3 |
| InChIKey | OSQIKVIUBSBBMR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|